C11H11NOS — CID 119087189
N,N-dimethyl-1-benzofuran-2-carbothioamide (PubChem CID 119087189) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is N,N-dimethyl-1-benzofuran-2-carbothioamide.
| Compound Name | N,N-dimethyl-1-benzofuran-2-carbothioamide |
|---|---|
| PubChem CID | 119087189 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | N,N-dimethyl-1-benzofuran-2-carbothioamide |
| SMILES | CN(C)C(=S)c1cc2ccccc2o1 |
| InChI | InChI=1S/C11H11NOS/c1-12(2)11(14)10-7-8-5-3-4-6-9(8)13-10/h3-7H,1-2H3 |
| InChIKey | KIGWCPFVPTUXQD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|