C25H33N3O2S — CID 20849757
1-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-1-(3,3,5-trimethylcyclohexyl)thiourea (PubChem CID 20849757) has the molecular formula C25H33N3O2S and a molecular weight of 439.63 g/mol. Its IUPAC name is 1-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-1-(3,3,5-trimethylcyclohexyl)thiourea.
| Compound Name | 1-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-1-(3,3,5-trimethylcyclohexyl)thiourea |
|---|---|
| PubChem CID | 20849757 |
| Molecular Formula | C25H33N3O2S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 1-[(E)-(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]-1-(3,3,5-trimethylcyclohexyl)thiourea |
| SMILES | COc1ccc(/C=N/N(C(N)=S)C2CC(C)CC(C)(C)C2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H33N3O2S/c1-18-12-21(15-25(2,3)14-18)28(24(26)31)27-16-20-10-11-22(29-4)23(13-20)30-17-19-8-6-5-7-9-19/h5-11,13,16,18,21H,12,14-15,17H2,1-4H3,(H2,26,31)/b27-16+ |
| InChIKey | QXAHBXLDFBIIQI-JVWAILMASA-N |
| XLogP | 5.37 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|