C19H16N4O3S — CID 20850778
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(quinoline-6-carbonylamino)thiourea (PubChem CID 20850778) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(quinoline-6-carbonylamino)thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(quinoline-6-carbonylamino)thiourea |
|---|---|
| PubChem CID | 20850778 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-(quinoline-6-carbonylamino)thiourea |
| SMILES | NC(=S)N(NC(=O)c1ccc2ncccc2c1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H16N4O3S/c20-19(27)23(14-4-6-16-17(11-14)26-9-8-25-16)22-18(24)13-3-5-15-12(10-13)2-1-7-21-15/h1-7,10-11H,8-9H2,(H2,20,27)(H,22,24) |
| InChIKey | LDBBPPQNWZAYAY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|