C25H21N5O6S2 — CID 78146635
O-[[2-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-pyridinyl]] N-[amino(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]carbamothioate (PubChem CID 78146635) has the molecular formula C25H21N5O6S2 and a molecular weight of 551.61 g/mol. Its IUPAC name is O-[[2-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-pyridinyl]] N-[amino(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]carbamothioate.
| Compound Name | O-[[2-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-pyridinyl]] N-[amino(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]carbamothioate |
|---|---|
| PubChem CID | 78146635 |
| Molecular Formula | C25H21N5O6S2 |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | O-[[2-(2,3-dihydro-1,4-benzodioxine-6-carbonylcarbamothioylamino)-3-pyridinyl]] N-[amino(2,3-dihydro-1,4-benzodioxin-6-yl)methylidene]carbamothioate |
| SMILES | NC(=NC(=S)Oc1cccnc1NC(=S)NC(=O)c1ccc2c(c1)OCCO2)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C25H21N5O6S2/c26-21(14-3-5-16-19(12-14)34-10-8-32-16)28-25(38)36-18-2-1-7-27-22(18)29-24(37)30-23(31)15-4-6-17-20(13-15)35-11-9-33-17/h1-7,12-13H,8-11H2,(H2,26,28,38)(H2,27,29,30,31,37) |
| InChIKey | GUWAGGDKNMKBIL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 138.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|