C14H14N4O5 — CID 20852247
1-[2-(2-ethylanilino)-2-oxoethyl]triazole-4,5-dicarboxylic acid (PubChem CID 20852247) has the molecular formula C14H14N4O5 and a molecular weight of 318.29 g/mol. Its IUPAC name is 1-[2-(2-ethylanilino)-2-oxoethyl]triazole-4,5-dicarboxylic acid.
| Compound Name | 1-[2-(2-ethylanilino)-2-oxoethyl]triazole-4,5-dicarboxylic acid |
|---|---|
| PubChem CID | 20852247 |
| Molecular Formula | C14H14N4O5 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-[2-(2-ethylanilino)-2-oxoethyl]triazole-4,5-dicarboxylic acid |
| SMILES | CCc1ccccc1NC(=O)Cn1nnc(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C14H14N4O5/c1-2-8-5-3-4-6-9(8)15-10(19)7-18-12(14(22)23)11(13(20)21)16-17-18/h3-6H,2,7H2,1H3,(H,15,19)(H,20,21)(H,22,23) |
| InChIKey | HOJXNFABQMKHDC-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |