C14H15N5O4 — CID 94935368
1-[2-(2-carbamoylanilino)-2-oxoethyl]-5-ethyltriazole-4-carboxylic acid (PubChem CID 94935368) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is 1-[2-(2-carbamoylanilino)-2-oxoethyl]-5-ethyltriazole-4-carboxylic acid.
| Compound Name | 1-[2-(2-carbamoylanilino)-2-oxoethyl]-5-ethyltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94935368 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 1-[2-(2-carbamoylanilino)-2-oxoethyl]-5-ethyltriazole-4-carboxylic acid |
| SMILES | CCc1c(C(=O)O)nnn1CC(=O)Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C14H15N5O4/c1-2-10-12(14(22)23)17-18-19(10)7-11(20)16-9-6-4-3-5-8(9)13(15)21/h3-6H,2,7H2,1H3,(H2,15,21)(H,16,20)(H,22,23) |
| InChIKey | HJIWRQJCLMPGQJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 140.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |