C18H13Cl2N5O3 — CID 20852269
N-(2,4-dichlorophenyl)-2-(4,6-dioxo-5-phenyl-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl)acetamide (PubChem CID 20852269) has the molecular formula C18H13Cl2N5O3 and a molecular weight of 418.24 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-(4,6-dioxo-5-phenyl-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl)acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-(4,6-dioxo-5-phenyl-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl)acetamide |
|---|---|
| PubChem CID | 20852269 |
| Molecular Formula | C18H13Cl2N5O3 |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-(4,6-dioxo-5-phenyl-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl)acetamide |
| SMILES | O=C(CN1N=NC2C(=O)N(c3ccccc3)C(=O)C21)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl2N5O3/c19-10-6-7-13(12(20)8-10)21-14(26)9-24-16-15(22-23-24)17(27)25(18(16)28)11-4-2-1-3-5-11/h1-8,15-16H,9H2,(H,21,26) |
| InChIKey | DOPBZKJQKIPJKX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|