C19H15Cl2N5O3 — CID 20852281
N-(2,4-dichlorophenyl)-2-[5-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetamide (PubChem CID 20852281) has the molecular formula C19H15Cl2N5O3 and a molecular weight of 432.27 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[5-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[5-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetamide |
|---|---|
| PubChem CID | 20852281 |
| Molecular Formula | C19H15Cl2N5O3 |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[5-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydropyrrolo[3,4-d]triazol-3-yl]acetamide |
| SMILES | Cc1ccc(N2C(=O)C3N=NN(CC(=O)Nc4ccc(Cl)cc4Cl)C3C2=O)cc1 |
| InChI | InChI=1S/C19H15Cl2N5O3/c1-10-2-5-12(6-3-10)26-18(28)16-17(19(26)29)25(24-23-16)9-15(27)22-14-7-4-11(20)8-13(14)21/h2-8,16-17H,9H2,1H3,(H,22,27) |
| InChIKey | YZWQRSJXDQGKSS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 94.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|