C26H30N4O2S — CID 20856272
N-[3-(N-ethyl-3-methylanilino)propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 20856272) has the molecular formula C26H30N4O2S and a molecular weight of 462.62 g/mol. Its IUPAC name is N-[3-(N-ethyl-3-methylanilino)propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[3-(N-ethyl-3-methylanilino)propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 20856272 |
| Molecular Formula | C26H30N4O2S |
| Molecular Weight | 462.62 g/mol |
| Exact Mass | 462.21 |
| IUPAC Name | N-[3-(N-ethyl-3-methylanilino)propyl]-3-(3-methoxyphenyl)-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | CCN(CCCNC(=O)c1cc2c(-c3cccc(OC)c3)nn(C)c2s1)c1cccc(C)c1 |
| InChI | InChI=1S/C26H30N4O2S/c1-5-30(20-11-6-9-18(2)15-20)14-8-13-27-25(31)23-17-22-24(28-29(3)26(22)33-23)19-10-7-12-21(16-19)32-4/h6-7,9-12,15-17H,5,8,13-14H2,1-4H3,(H,27,31) |
| InChIKey | JWOKERDELXORSV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|