C27H33N5O2 — CID 20858416
1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]-4-piperidin-1-ylpiperidine-4-carboxamide (PubChem CID 20858416) has the molecular formula C27H33N5O2 and a molecular weight of 459.59 g/mol. Its IUPAC name is 1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]-4-piperidin-1-ylpiperidine-4-carboxamide.
| Compound Name | 1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 20858416 |
| Molecular Formula | C27H33N5O2 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 1-[3-(4-ethylphenyl)-4-oxoquinazolin-2-yl]-4-piperidin-1-ylpiperidine-4-carboxamide |
| SMILES | CCc1ccc(-n2c(N3CCC(C(N)=O)(N4CCCCC4)CC3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C27H33N5O2/c1-2-20-10-12-21(13-11-20)32-24(33)22-8-4-5-9-23(22)29-26(32)30-18-14-27(15-19-30,25(28)34)31-16-6-3-7-17-31/h4-5,8-13H,2-3,6-7,14-19H2,1H3,(H2,28,34) |
| InChIKey | YSIISYOZMFLNQS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |