C27H42N4O4S — CID 20859177
6-[cyclohexyl(methyl)sulfamoyl]-N-[3-(dipropylamino)propyl]-1-methyl-4-oxoquinoline-3-carboxamide (PubChem CID 20859177) has the molecular formula C27H42N4O4S and a molecular weight of 518.72 g/mol. Its IUPAC name is 6-[cyclohexyl(methyl)sulfamoyl]-N-[3-(dipropylamino)propyl]-1-methyl-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-[cyclohexyl(methyl)sulfamoyl]-N-[3-(dipropylamino)propyl]-1-methyl-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 20859177 |
| Molecular Formula | C27H42N4O4S |
| Molecular Weight | 518.72 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 6-[cyclohexyl(methyl)sulfamoyl]-N-[3-(dipropylamino)propyl]-1-methyl-4-oxoquinoline-3-carboxamide |
| SMILES | CCCN(CCC)CCCNC(=O)c1cn(C)c2ccc(S(=O)(=O)N(C)C3CCCCC3)cc2c1=O |
| InChI | InChI=1S/C27H42N4O4S/c1-5-16-31(17-6-2)18-10-15-28-27(33)24-20-29(3)25-14-13-22(19-23(25)26(24)32)36(34,35)30(4)21-11-8-7-9-12-21/h13-14,19-21H,5-12,15-18H2,1-4H3,(H,28,33) |
| InChIKey | PFHHAWRUJHLZPE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 91.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.72 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|