C23H33N3O5S — CID 5307227
6-[cyclohexyl(methyl)sulfamoyl]-1-ethyl-N-(3-methoxypropyl)-4-oxoquinoline-3-carboxamide (PubChem CID 5307227) has the molecular formula C23H33N3O5S and a molecular weight of 463.60 g/mol. Its IUPAC name is 6-[cyclohexyl(methyl)sulfamoyl]-1-ethyl-N-(3-methoxypropyl)-4-oxoquinoline-3-carboxamide.
| Compound Name | 6-[cyclohexyl(methyl)sulfamoyl]-1-ethyl-N-(3-methoxypropyl)-4-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 5307227 |
| Molecular Formula | C23H33N3O5S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 6-[cyclohexyl(methyl)sulfamoyl]-1-ethyl-N-(3-methoxypropyl)-4-oxoquinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCCCOC)c(=O)c2cc(S(=O)(=O)N(C)C3CCCCC3)ccc21 |
| InChI | InChI=1S/C23H33N3O5S/c1-4-26-16-20(23(28)24-13-8-14-31-3)22(27)19-15-18(11-12-21(19)26)32(29,30)25(2)17-9-6-5-7-10-17/h11-12,15-17H,4-10,13-14H2,1-3H3,(H,24,28) |
| InChIKey | CQJLSHBCBCNPRX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|