C17H19F3N2O3 — CID 30133526
1-ethyl-N-(3-methoxypropyl)-4-oxo-6-(trifluoromethyl)quinoline-3-carboxamide (PubChem CID 30133526) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is 1-ethyl-N-(3-methoxypropyl)-4-oxo-6-(trifluoromethyl)quinoline-3-carboxamide.
| Compound Name | 1-ethyl-N-(3-methoxypropyl)-4-oxo-6-(trifluoromethyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 30133526 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 1-ethyl-N-(3-methoxypropyl)-4-oxo-6-(trifluoromethyl)quinoline-3-carboxamide |
| SMILES | CCn1cc(C(=O)NCCCOC)c(=O)c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C17H19F3N2O3/c1-3-22-10-13(16(24)21-7-4-8-25-2)15(23)12-9-11(17(18,19)20)5-6-14(12)22/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,21,24) |
| InChIKey | RSFVVJDRAPGEKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|