C20H25NO3S — CID 20859500
N-(4-methylcyclohexyl)-5-[(4-methylphenyl)sulfinylmethyl]furan-2-carboxamide (PubChem CID 20859500) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-5-[(4-methylphenyl)sulfinylmethyl]furan-2-carboxamide.
| Compound Name | N-(4-methylcyclohexyl)-5-[(4-methylphenyl)sulfinylmethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 20859500 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-(4-methylcyclohexyl)-5-[(4-methylphenyl)sulfinylmethyl]furan-2-carboxamide |
| SMILES | Cc1ccc(S(=O)Cc2ccc(C(=O)NC3CCC(C)CC3)o2)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-14-3-7-16(8-4-14)21-20(22)19-12-9-17(24-19)13-25(23)18-10-5-15(2)6-11-18/h5-6,9-12,14,16H,3-4,7-8,13H2,1-2H3,(H,21,22) |
| InChIKey | KOBJMTHXPUSKDF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |