C20H28N2O6S — CID 20860569
2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-ethoxypropyl)acetamide (PubChem CID 20860569) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-ethoxypropyl)acetamide.
| Compound Name | 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-ethoxypropyl)acetamide |
|---|---|
| PubChem CID | 20860569 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]-N-(3-ethoxypropyl)acetamide |
| SMILES | CCOCCCNC(=O)CS(=O)Cc1nc(-c2ccc(OC)c(OC)c2)oc1C |
| InChI | InChI=1S/C20H28N2O6S/c1-5-27-10-6-9-21-19(23)13-29(24)12-16-14(2)28-20(22-16)15-7-8-17(25-3)18(11-15)26-4/h7-8,11H,5-6,9-10,12-13H2,1-4H3,(H,21,23) |
| InChIKey | XAXPLFYRFZPSLT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|