C24H34N2O5S2 — CID 92662725
N-(3-cyclohexylsulfanylpropyl)-2-[(R)-[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]acetamide (PubChem CID 92662725) has the molecular formula C24H34N2O5S2 and a molecular weight of 494.68 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-[(R)-[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-[(R)-[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]acetamide |
|---|---|
| PubChem CID | 92662725 |
| Molecular Formula | C24H34N2O5S2 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-[(R)-[2-(3,4-dimethoxyphenyl)-5-methyl-1,3-oxazol-4-yl]methylsulfinyl]acetamide |
| SMILES | COc1ccc(-c2nc(C[S@@](=O)CC(=O)NCCCSC3CCCCC3)c(C)o2)cc1OC |
| InChI | InChI=1S/C24H34N2O5S2/c1-17-20(26-24(31-17)18-10-11-21(29-2)22(14-18)30-3)15-33(28)16-23(27)25-12-7-13-32-19-8-5-4-6-9-19/h10-11,14,19H,4-9,12-13,15-16H2,1-3H3,(H,25,27)/t33-/m1/s1 |
| InChIKey | RDFDKMDXHLEKSB-MGBGTMOVSA-N |
| XLogP | 4.49 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|