C18H20N4O3S3 — CID 2086174
N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide (PubChem CID 2086174) has the molecular formula C18H20N4O3S3 and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 2086174 |
| Molecular Formula | C18H20N4O3S3 |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | N-[2-(2,4-dioxo-1,3-thiazolidin-3-yl)ethyl]-2-[[(7R)-7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl]sulfanyl]acetamide |
| SMILES | C[C@@H]1CCc2c(sc3ncnc(SCC(=O)NCCN4C(=O)CSC4=O)c23)C1 |
| InChI | InChI=1S/C18H20N4O3S3/c1-10-2-3-11-12(6-10)28-17-15(11)16(20-9-21-17)26-7-13(23)19-4-5-22-14(24)8-27-18(22)25/h9-10H,2-8H2,1H3,(H,19,23)/t10-/m1/s1 |
| InChIKey | CLEURBGBQHAFHU-SNVBAGLBSA-N |
| XLogP | 2.72 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|