C25H31N3O3S2 — CID 44644526
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide (PubChem CID 44644526) has the molecular formula C25H31N3O3S2 and a molecular weight of 485.68 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 44644526 |
| Molecular Formula | C25H31N3O3S2 |
| Molecular Weight | 485.68 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7-methyl-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-yl)sulfanyl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)CSc2ncnc3sc4c(c23)CCC(C)C4)cc1OCC |
| InChI | InChI=1S/C25H31N3O3S2/c1-4-30-19-9-7-17(13-20(19)31-5-2)10-11-26-22(29)14-32-24-23-18-8-6-16(3)12-21(18)33-25(23)28-15-27-24/h7,9,13,15-16H,4-6,8,10-12,14H2,1-3H3,(H,26,29) |
| InChIKey | OSKRIVOLHCBMRR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.68 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |