C25H31N3O4S — CID 40903515
N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide (PubChem CID 40903515) has the molecular formula C25H31N3O4S and a molecular weight of 469.61 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
|---|---|
| PubChem CID | 40903515 |
| Molecular Formula | C25H31N3O4S |
| Molecular Weight | 469.61 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-2-[(7R)-7-methyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-3-yl]acetamide |
| SMILES | CCOc1ccc(CCNC(=O)Cn2cnc3sc4c(c3c2=O)CC[C@@H](C)C4)cc1OCC |
| InChI | InChI=1S/C25H31N3O4S/c1-4-31-19-9-7-17(13-20(19)32-5-2)10-11-26-22(29)14-28-15-27-24-23(25(28)30)18-8-6-16(3)12-21(18)33-24/h7,9,13,15-16H,4-6,8,10-12,14H2,1-3H3,(H,26,29)/t16-/m1/s1 |
| InChIKey | AVKZQVFFYCRLCQ-MRXNPFEDSA-N |
| XLogP | 3.74 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.61 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |