C23H15F2NO5S — CID 20864496
N-[(4-fluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-oxochromene-6-carboxamide (PubChem CID 20864496) has the molecular formula C23H15F2NO5S and a molecular weight of 455.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-oxochromene-6-carboxamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-oxochromene-6-carboxamide |
|---|---|
| PubChem CID | 20864496 |
| Molecular Formula | C23H15F2NO5S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-3-(4-fluorophenyl)sulfonyl-2-oxochromene-6-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc2oc(=O)c(S(=O)(=O)c3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C23H15F2NO5S/c24-17-4-1-14(2-5-17)13-26-22(27)15-3-10-20-16(11-15)12-21(23(28)31-20)32(29,30)19-8-6-18(25)7-9-19/h1-12H,13H2,(H,26,27) |
| InChIKey | BDFCEMCELAKTTK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|