C29H36N4O2 — CID 20867964
10-[2-(azepan-1-yl)ethylamino]-12-(3,5-dimethylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20867964) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 10-[2-(azepan-1-yl)ethylamino]-12-(3,5-dimethylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 10-[2-(azepan-1-yl)ethylamino]-12-(3,5-dimethylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20867964 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 10-[2-(azepan-1-yl)ethylamino]-12-(3,5-dimethylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC1CC(C)CN(c2cc(NCCN3CCCCCC3)c3c4c(onc24)-c2ccccc2C3=O)C1 |
| InChI | InChI=1S/C29H36N4O2/c1-19-15-20(2)18-33(17-19)24-16-23(30-11-14-32-12-7-3-4-8-13-32)25-26-27(24)31-35-29(26)22-10-6-5-9-21(22)28(25)34/h5-6,9-10,16,19-20,30H,3-4,7-8,11-15,17-18H2,1-2H3 |
| InChIKey | QCUXZKAPDFXETN-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|