C25H27N3O2 — CID 20868008
12-(4-methylpiperidin-1-yl)-10-piperidin-1-yl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868008) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 12-(4-methylpiperidin-1-yl)-10-piperidin-1-yl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(4-methylpiperidin-1-yl)-10-piperidin-1-yl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868008 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 12-(4-methylpiperidin-1-yl)-10-piperidin-1-yl-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC1CCN(c2cc(N3CCCCC3)c3c4c(onc24)-c2ccccc2C3=O)CC1 |
| InChI | InChI=1S/C25H27N3O2/c1-16-9-13-28(14-10-16)20-15-19(27-11-5-2-6-12-27)21-22-23(20)26-30-25(22)18-8-4-3-7-17(18)24(21)29/h3-4,7-8,15-16H,2,5-6,9-14H2,1H3 |
| InChIKey | QUAZAMGIZICPQZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|