C23H25N3O3 — CID 20868197
12-[2-hydroxyethyl(methyl)amino]-10-(4-methylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 20868197) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is 12-[2-hydroxyethyl(methyl)amino]-10-(4-methylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-[2-hydroxyethyl(methyl)amino]-10-(4-methylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 20868197 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 12-[2-hydroxyethyl(methyl)amino]-10-(4-methylpiperidin-1-yl)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | CC1CCN(c2cc(N(C)CCO)c3noc4c3c2C(=O)c2ccccc2-4)CC1 |
| InChI | InChI=1S/C23H25N3O3/c1-14-7-9-26(10-8-14)17-13-18(25(2)11-12-27)21-20-19(17)22(28)15-5-3-4-6-16(15)23(20)29-24-21/h3-6,13-14,27H,7-12H2,1-2H3 |
| InChIKey | KQKIKBFTPZBZAG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|