C15H18Br2N2O5 — CID 20871696
(2R)-4-(4-amino-3,5-dibromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid (PubChem CID 20871696) has the molecular formula C15H18Br2N2O5 and a molecular weight of 466.13 g/mol. Its IUPAC name is (2R)-4-(4-amino-3,5-dibromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid.
| Compound Name | (2R)-4-(4-amino-3,5-dibromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 20871696 |
| Molecular Formula | C15H18Br2N2O5 |
| Molecular Weight | 466.13 g/mol |
| Exact Mass | 463.96 |
| IUPAC Name | (2R)-4-(4-amino-3,5-dibromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)c1cc(Br)c(N)c(Br)c1)C(=O)O |
| InChI | InChI=1S/C15H18Br2N2O5/c1-15(2,3)24-14(23)19-10(13(21)22)6-11(20)7-4-8(16)12(18)9(17)5-7/h4-5,10H,6,18H2,1-3H3,(H,19,23)(H,21,22)/t10-/m1/s1 |
| InChIKey | KRJLMPNYERLPQD-SNVBAGLBSA-N |
| XLogP | 3.34 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|