C17H15Br4N3O2 — CID 139948603
3-amino-1,5-bis(4-amino-3,5-dibromophenyl)pentane-1,5-dione (PubChem CID 139948603) has the molecular formula C17H15Br4N3O2 and a molecular weight of 612.94 g/mol. Its IUPAC name is 3-amino-1,5-bis(4-amino-3,5-dibromophenyl)pentane-1,5-dione.
| Compound Name | 3-amino-1,5-bis(4-amino-3,5-dibromophenyl)pentane-1,5-dione |
|---|---|
| PubChem CID | 139948603 |
| Molecular Formula | C17H15Br4N3O2 |
| Molecular Weight | 612.94 g/mol |
| Exact Mass | 608.79 |
| IUPAC Name | 3-amino-1,5-bis(4-amino-3,5-dibromophenyl)pentane-1,5-dione |
| SMILES | Nc1c(Br)cc(C(=O)CC(N)CC(=O)c2cc(Br)c(N)c(Br)c2)cc1Br |
| InChI | InChI=1S/C17H15Br4N3O2/c18-10-1-7(2-11(19)16(10)23)14(25)5-9(22)6-15(26)8-3-12(20)17(24)13(21)4-8/h1-4,9H,5-6,22-24H2 |
| InChIKey | BMGDGRQKKLSTBP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|