C18H24ClNO4 — CID 20871717
2-(4-chlorophenoxy)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)acetamide (PubChem CID 20871717) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)acetamide |
|---|---|
| PubChem CID | 20871717 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(2,7-dimethyl-3,6-dioxooctan-4-yl)acetamide |
| SMILES | CC(C)C(=O)CC(NC(=O)COc1ccc(Cl)cc1)C(=O)C(C)C |
| InChI | InChI=1S/C18H24ClNO4/c1-11(2)16(21)9-15(18(23)12(3)4)20-17(22)10-24-14-7-5-13(19)6-8-14/h5-8,11-12,15H,9-10H2,1-4H3,(H,20,22) |
| InChIKey | JJQKKSZPAFNQAZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |