C18H32N2O2 — CID 20871993
4-butyl-6,7-ditert-butyl-1-methyl-2H-1,4-diazepine-3,5-dione (PubChem CID 20871993) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-butyl-6,7-ditert-butyl-1-methyl-2H-1,4-diazepine-3,5-dione.
| Compound Name | 4-butyl-6,7-ditert-butyl-1-methyl-2H-1,4-diazepine-3,5-dione |
|---|---|
| PubChem CID | 20871993 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 4-butyl-6,7-ditert-butyl-1-methyl-2H-1,4-diazepine-3,5-dione |
| SMILES | CCCCN1C(=O)CN(C)C(C(C)(C)C)=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H32N2O2/c1-9-10-11-20-13(21)12-19(8)15(18(5,6)7)14(16(20)22)17(2,3)4/h9-12H2,1-8H3 |
| InChIKey | XIFRDEGHOIGQJX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|