About 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one
2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one (PubChem CID 20871985) has the molecular formula C16H30N2O
and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one.
Molecular Properties
| Compound Name | 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one |
| PubChem CID | 20871985 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one |
| SMILES | CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C16H30N2O/c1-8-9-10-18-11-12(15(2,3)4)13(14(19)17-18)16(5,6)7/h8-11H2,1-7H3,(H,17,19) |
| InChIKey | NPSSDGFVVQLQPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one?
The IUPAC name of 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one (CID 20871985) is 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one.
What is the SMILES notation for 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one?
The canonical SMILES for 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one is CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1.
What is the InChIKey of 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one?
The InChIKey is NPSSDGFVVQLQPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O/c1-8-9-10-18-11-12(15(2,3)4)13(14(19)17-18)16(5,6)7/h8-11H2,1-7H3,(H,17,19).
What are the key properties of 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one?
2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one has a molecular weight of 266.43 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one is sourced from PubChem (CID 20871985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).