C16H30N2O — CID 20871985
2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one (PubChem CID 20871985) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one.
| Compound Name | 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one |
|---|---|
| PubChem CID | 20871985 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-butyl-4,5-ditert-butyl-1,3-dihydropyridazin-6-one |
| SMILES | CCCCN1CC(C(C)(C)C)=C(C(C)(C)C)C(=O)N1 |
| InChI | InChI=1S/C16H30N2O/c1-8-9-10-18-11-12(15(2,3)4)13(14(19)17-18)16(5,6)7/h8-11H2,1-7H3,(H,17,19) |
| InChIKey | NPSSDGFVVQLQPB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |