About ethyl N'-methoxycarbamimidate
ethyl N'-methoxycarbamimidate (PubChem CID 20872274) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is ethyl N'-methoxycarbamimidate.
Molecular Properties
| Compound Name | ethyl N'-methoxycarbamimidate |
| PubChem CID | 20872274 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | ethyl N'-methoxycarbamimidate |
| SMILES | CCO/C(N)=N/OC |
| InChI | InChI=1S/C4H10N2O2/c1-3-8-4(5)6-7-2/h3H2,1-2H3,(H2,5,6) |
| InChIKey | VWWSKQMQDYXHJM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-methoxycarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-methoxycarbamimidate?
The IUPAC name of ethyl N'-methoxycarbamimidate (CID 20872274) is ethyl N'-methoxycarbamimidate.
What is the SMILES notation for ethyl N'-methoxycarbamimidate?
The canonical SMILES for ethyl N'-methoxycarbamimidate is CCO/C(N)=N/OC.
What is the InChIKey of ethyl N'-methoxycarbamimidate?
The InChIKey is VWWSKQMQDYXHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2/c1-3-8-4(5)6-7-2/h3H2,1-2H3,(H2,5,6).
What are the key properties of ethyl N'-methoxycarbamimidate?
ethyl N'-methoxycarbamimidate has a molecular weight of 118.14 g/mol, XLogP of -0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-methoxycarbamimidate is sourced from PubChem (CID 20872274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).