About 2-hydroxy-N'-methoxyethanimidamide
2-hydroxy-N'-methoxyethanimidamide (PubChem CID 126677071) has the molecular formula C3H8N2O2
and a molecular weight of 104.11 g/mol. Its IUPAC name is 2-hydroxy-N'-methoxyethanimidamide.
Molecular Properties
| Compound Name | 2-hydroxy-N'-methoxyethanimidamide |
| PubChem CID | 126677071 |
| Molecular Formula | C3H8N2O2 |
| Molecular Weight | 104.11 g/mol |
| Exact Mass | 104.06 |
| IUPAC Name | 2-hydroxy-N'-methoxyethanimidamide |
| SMILES | CO/N=C(\N)CO |
| InChI | InChI=1S/C3H8N2O2/c1-7-5-3(4)2-6/h6H,2H2,1H3,(H2,4,5) |
| InChIKey | UDDHBUDQJLBBPO-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.11 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-N'-methoxyethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-N'-methoxyethanimidamide?
The IUPAC name of 2-hydroxy-N'-methoxyethanimidamide (CID 126677071) is 2-hydroxy-N'-methoxyethanimidamide.
What is the SMILES notation for 2-hydroxy-N'-methoxyethanimidamide?
The canonical SMILES for 2-hydroxy-N'-methoxyethanimidamide is CO/N=C(\N)CO.
What is the InChIKey of 2-hydroxy-N'-methoxyethanimidamide?
The InChIKey is UDDHBUDQJLBBPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8N2O2/c1-7-5-3(4)2-6/h6H,2H2,1H3,(H2,4,5).
What are the key properties of 2-hydroxy-N'-methoxyethanimidamide?
2-hydroxy-N'-methoxyethanimidamide has a molecular weight of 104.11 g/mol, XLogP of -1.10, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-N'-methoxyethanimidamide is sourced from PubChem (CID 126677071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).