C23H27F2N3O3 — CID 20872681
[(E)-(2,4-difluorophenyl)methylideneamino] N-[4-(nonanoylamino)phenyl]carbamate (PubChem CID 20872681) has the molecular formula C23H27F2N3O3 and a molecular weight of 431.48 g/mol. Its IUPAC name is [(E)-(2,4-difluorophenyl)methylideneamino] N-[4-(nonanoylamino)phenyl]carbamate.
| Compound Name | [(E)-(2,4-difluorophenyl)methylideneamino] N-[4-(nonanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 20872681 |
| Molecular Formula | C23H27F2N3O3 |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | [(E)-(2,4-difluorophenyl)methylideneamino] N-[4-(nonanoylamino)phenyl]carbamate |
| SMILES | CCCCCCCCC(=O)Nc1ccc(NC(=O)O/N=C/c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C23H27F2N3O3/c1-2-3-4-5-6-7-8-22(29)27-19-11-13-20(14-12-19)28-23(30)31-26-16-17-9-10-18(24)15-21(17)25/h9-16H,2-8H2,1H3,(H,27,29)(H,28,30)/b26-16+ |
| InChIKey | CIKGHCCGRQRCDM-WGOQTCKBSA-N |
| XLogP | 6.24 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|