C32H31N7O — CID 20874905
1-(4-benzylpiperidin-1-yl)-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butan-1-one (PubChem CID 20874905) has the molecular formula C32H31N7O and a molecular weight of 529.65 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butan-1-one.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butan-1-one |
|---|---|
| PubChem CID | 20874905 |
| Molecular Formula | C32H31N7O |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.26 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-4-(9-phenyl-2,4,5,7,8,10-hexazatetracyclo[10.4.0.02,6.07,11]hexadeca-1(16),3,5,8,10,12,14-heptaen-3-yl)butan-1-one |
| SMILES | O=C(CCCc1nnc2n3nc(-c4ccccc4)nc3c3ccccc3n12)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C32H31N7O/c40-29(37-20-18-24(19-21-37)22-23-10-3-1-4-11-23)17-9-16-28-34-35-32-38(28)27-15-8-7-14-26(27)31-33-30(36-39(31)32)25-12-5-2-6-13-25/h1-8,10-15,24H,9,16-22H2 |
| InChIKey | LBSZUNFKJABIST-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 80.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |