C25H38N4O5S — CID 20876459
N-[3-(3-methylpiperidin-1-yl)propyl]-2-[6-(4-methylpiperidin-1-yl)sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 20876459) has the molecular formula C25H38N4O5S and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[3-(3-methylpiperidin-1-yl)propyl]-2-[6-(4-methylpiperidin-1-yl)sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-[3-(3-methylpiperidin-1-yl)propyl]-2-[6-(4-methylpiperidin-1-yl)sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 20876459 |
| Molecular Formula | C25H38N4O5S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | N-[3-(3-methylpiperidin-1-yl)propyl]-2-[6-(4-methylpiperidin-1-yl)sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | CC1CCN(S(=O)(=O)c2ccc3c(c2)N(CC(=O)NCCCN2CCCC(C)C2)C(=O)CO3)CC1 |
| InChI | InChI=1S/C25H38N4O5S/c1-19-8-13-28(14-9-19)35(32,33)21-6-7-23-22(15-21)29(25(31)18-34-23)17-24(30)26-10-4-12-27-11-3-5-20(2)16-27/h6-7,15,19-20H,3-5,8-14,16-18H2,1-2H3,(H,26,30) |
| InChIKey | VIVSSNFQUWLSLN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|