C26H39N3O5S2 — CID 92667142
N-(3-cyclohexylsulfanylpropyl)-2-[6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide (PubChem CID 92667142) has the molecular formula C26H39N3O5S2 and a molecular weight of 537.75 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-[6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-[6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
|---|---|
| PubChem CID | 92667142 |
| Molecular Formula | C26H39N3O5S2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-[6-[(3S,5R)-3,5-dimethylpiperidin-1-yl]sulfonyl-3-oxo-1,4-benzoxazin-4-yl]acetamide |
| SMILES | C[C@@H]1C[C@H](C)CN(S(=O)(=O)c2ccc3c(c2)N(CC(=O)NCCCSC2CCCCC2)C(=O)CO3)C1 |
| InChI | InChI=1S/C26H39N3O5S2/c1-19-13-20(2)16-28(15-19)36(32,33)22-9-10-24-23(14-22)29(26(31)18-34-24)17-25(30)27-11-6-12-35-21-7-4-3-5-8-21/h9-10,14,19-21H,3-8,11-13,15-18H2,1-2H3,(H,27,30)/t19-,20+ |
| InChIKey | GBPZTJWGMDXYNG-BGYRXZFFSA-N |
| XLogP | 3.65 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|