C20H19ClN2O2S — CID 20882607
3-(4-chlorophenyl)sulfonyl-4-piperidin-1-ylquinoline (PubChem CID 20882607) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-4-piperidin-1-ylquinoline.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-4-piperidin-1-ylquinoline |
|---|---|
| PubChem CID | 20882607 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-4-piperidin-1-ylquinoline |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1cnc2ccccc2c1N1CCCCC1 |
| InChI | InChI=1S/C20H19ClN2O2S/c21-15-8-10-16(11-9-15)26(24,25)19-14-22-18-7-3-2-6-17(18)20(19)23-12-4-1-5-13-23/h2-3,6-11,14H,1,4-5,12-13H2 |
| InChIKey | HWFXGXZYNPSHOI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |