C15H8Cl3NO2S — CID 56923453
4,7-dichloro-3-(4-chlorophenyl)sulfonylquinoline (PubChem CID 56923453) has the molecular formula C15H8Cl3NO2S and a molecular weight of 372.66 g/mol. Its IUPAC name is 4,7-dichloro-3-(4-chlorophenyl)sulfonylquinoline.
| Compound Name | 4,7-dichloro-3-(4-chlorophenyl)sulfonylquinoline |
|---|---|
| PubChem CID | 56923453 |
| Molecular Formula | C15H8Cl3NO2S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 4,7-dichloro-3-(4-chlorophenyl)sulfonylquinoline |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)c1cnc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C15H8Cl3NO2S/c16-9-1-4-11(5-2-9)22(20,21)14-8-19-13-7-10(17)3-6-12(13)15(14)18/h1-8H |
| InChIKey | ICKIACAKKXTULJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |