C24H21ClN2O3S — CID 18560312
6-chloro-N-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylquinolin-4-amine (PubChem CID 18560312) has the molecular formula C24H21ClN2O3S and a molecular weight of 452.96 g/mol. Its IUPAC name is 6-chloro-N-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylquinolin-4-amine.
| Compound Name | 6-chloro-N-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylquinolin-4-amine |
|---|---|
| PubChem CID | 18560312 |
| Molecular Formula | C24H21ClN2O3S |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 6-chloro-N-[(4-methoxyphenyl)methyl]-3-(4-methylphenyl)sulfonylquinolin-4-amine |
| SMILES | COc1ccc(CNc2c(S(=O)(=O)c3ccc(C)cc3)cnc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C24H21ClN2O3S/c1-16-3-10-20(11-4-16)31(28,29)23-15-26-22-12-7-18(25)13-21(22)24(23)27-14-17-5-8-19(30-2)9-6-17/h3-13,15H,14H2,1-2H3,(H,26,27) |
| InChIKey | XOXVNSSHKHSLNQ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |