C24H23N2O3S+ — CID 7184675
3-(benzenesulfonyl)-6-methoxy-N-[(4-methylphenyl)methyl]quinolin-1-ium-4-amine (PubChem CID 7184675) has the molecular formula C24H23N2O3S+ and a molecular weight of 419.53 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-6-methoxy-N-[(4-methylphenyl)methyl]quinolin-1-ium-4-amine.
| Compound Name | 3-(benzenesulfonyl)-6-methoxy-N-[(4-methylphenyl)methyl]quinolin-1-ium-4-amine |
|---|---|
| PubChem CID | 7184675 |
| Molecular Formula | C24H23N2O3S+ |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 3-(benzenesulfonyl)-6-methoxy-N-[(4-methylphenyl)methyl]quinolin-1-ium-4-amine |
| SMILES | COc1ccc2[nH+]cc(S(=O)(=O)c3ccccc3)c(NCc3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C24H22N2O3S/c1-17-8-10-18(11-9-17)15-26-24-21-14-19(29-2)12-13-22(21)25-16-23(24)30(27,28)20-6-4-3-5-7-20/h3-14,16H,15H2,1-2H3,(H,25,26)/p+1 |
| InChIKey | KAGMYSWSSKXSEA-UHFFFAOYSA-O |
| XLogP | 4.42 |
| TPSA | 69.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |