C23H29N3O3S+2 — CID 7184485
3-(4-ethylphenyl)sulfonyl-6-methoxy-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium (PubChem CID 7184485) has the molecular formula C23H29N3O3S+2 and a molecular weight of 427.57 g/mol. Its IUPAC name is 3-(4-ethylphenyl)sulfonyl-6-methoxy-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium.
| Compound Name | 3-(4-ethylphenyl)sulfonyl-6-methoxy-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 7184485 |
| Molecular Formula | C23H29N3O3S+2 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3-(4-ethylphenyl)sulfonyl-6-methoxy-4-(4-methylpiperazin-4-ium-1-yl)quinolin-1-ium |
| SMILES | CCc1ccc(S(=O)(=O)c2c[nH+]c3ccc(OC)cc3c2N2CC[NH+](C)CC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-4-17-5-8-19(9-6-17)30(27,28)22-16-24-21-10-7-18(29-3)15-20(21)23(22)26-13-11-25(2)12-14-26/h5-10,15-16H,4,11-14H2,1-3H3/p+2 |
| InChIKey | NSUPWNKZKATWEA-UHFFFAOYSA-P |
| XLogP | 1.39 |
| TPSA | 65.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |