C24H29N2O3S+ — CID 7184119
6-ethyl-3-(4-methoxyphenyl)sulfonyl-4-(4-methylpiperidin-1-yl)quinolin-1-ium (PubChem CID 7184119) has the molecular formula C24H29N2O3S+ and a molecular weight of 425.57 g/mol. Its IUPAC name is 6-ethyl-3-(4-methoxyphenyl)sulfonyl-4-(4-methylpiperidin-1-yl)quinolin-1-ium.
| Compound Name | 6-ethyl-3-(4-methoxyphenyl)sulfonyl-4-(4-methylpiperidin-1-yl)quinolin-1-ium |
|---|---|
| PubChem CID | 7184119 |
| Molecular Formula | C24H29N2O3S+ |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 6-ethyl-3-(4-methoxyphenyl)sulfonyl-4-(4-methylpiperidin-1-yl)quinolin-1-ium |
| SMILES | CCc1ccc2[nH+]cc(S(=O)(=O)c3ccc(OC)cc3)c(N3CCC(C)CC3)c2c1 |
| InChI | InChI=1S/C24H28N2O3S/c1-4-18-5-10-22-21(15-18)24(26-13-11-17(2)12-14-26)23(16-25-22)30(27,28)20-8-6-19(29-3)7-9-20/h5-10,15-17H,4,11-14H2,1-3H3/p+1 |
| InChIKey | NRJDVCJHKFGQIW-UHFFFAOYSA-O |
| XLogP | 4.29 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |