C23H27N2O3S+ — CID 2151722
4-[3-(3,4-dimethylphenyl)sulfonyl-6-ethylquinolin-1-ium-4-yl]morpholine (PubChem CID 2151722) has the molecular formula C23H27N2O3S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[3-(3,4-dimethylphenyl)sulfonyl-6-ethylquinolin-1-ium-4-yl]morpholine.
| Compound Name | 4-[3-(3,4-dimethylphenyl)sulfonyl-6-ethylquinolin-1-ium-4-yl]morpholine |
|---|---|
| PubChem CID | 2151722 |
| Molecular Formula | C23H27N2O3S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-[3-(3,4-dimethylphenyl)sulfonyl-6-ethylquinolin-1-ium-4-yl]morpholine |
| SMILES | CCc1ccc2[nH+]cc(S(=O)(=O)c3ccc(C)c(C)c3)c(N3CCOCC3)c2c1 |
| InChI | InChI=1S/C23H26N2O3S/c1-4-18-6-8-21-20(14-18)23(25-9-11-28-12-10-25)22(15-24-21)29(26,27)19-7-5-16(2)17(3)13-19/h5-8,13-15H,4,9-12H2,1-3H3/p+1 |
| InChIKey | RYGMIACNQFRSLZ-UHFFFAOYSA-O |
| XLogP | 3.50 |
| TPSA | 60.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |