C27H28N3O2S+ — CID 2140994
4-(4-benzylpiperazin-1-yl)-3-(4-methylphenyl)sulfonylquinolin-1-ium (PubChem CID 2140994) has the molecular formula C27H28N3O2S+ and a molecular weight of 458.61 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-3-(4-methylphenyl)sulfonylquinolin-1-ium.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-3-(4-methylphenyl)sulfonylquinolin-1-ium |
|---|---|
| PubChem CID | 2140994 |
| Molecular Formula | C27H28N3O2S+ |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-3-(4-methylphenyl)sulfonylquinolin-1-ium |
| SMILES | Cc1ccc(S(=O)(=O)c2c[nH+]c3ccccc3c2N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H27N3O2S/c1-21-11-13-23(14-12-21)33(31,32)26-19-28-25-10-6-5-9-24(25)27(26)30-17-15-29(16-18-30)20-22-7-3-2-4-8-22/h2-14,19H,15-18,20H2,1H3/p+1 |
| InChIKey | SEIXYLKFVCGARR-UHFFFAOYSA-O |
| XLogP | 4.12 |
| TPSA | 54.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |