C27H29N5O2S — CID 2453226
N-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 2453226) has the molecular formula C27H29N5O2S and a molecular weight of 487.63 g/mol. Its IUPAC name is N-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 2453226 |
| Molecular Formula | C27H29N5O2S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2nc3ccccc3nc2N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C27H29N5O2S/c1-21-12-14-23(15-13-21)35(33,34)30(2)26-27(29-25-11-7-6-10-24(25)28-26)32-18-16-31(17-19-32)20-22-8-4-3-5-9-22/h3-15H,16-20H2,1-2H3 |
| InChIKey | HTZHEBJRUUNZLP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |