C20H24N4O3S — CID 8005322
N-[3-(3-methoxypropylamino)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide (PubChem CID 8005322) has the molecular formula C20H24N4O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is N-[3-(3-methoxypropylamino)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-[3-(3-methoxypropylamino)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8005322 |
| Molecular Formula | C20H24N4O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | N-[3-(3-methoxypropylamino)quinoxalin-2-yl]-N,4-dimethylbenzenesulfonamide |
| SMILES | COCCCNc1nc2ccccc2nc1N(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H24N4O3S/c1-15-9-11-16(12-10-15)28(25,26)24(2)20-19(21-13-6-14-27-3)22-17-7-4-5-8-18(17)23-20/h4-5,7-12H,6,13-14H2,1-3H3,(H,21,22) |
| InChIKey | PFOFRCXRTJNJAS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|