C19H20ClN3O2S — CID 2392249
N-butyl-N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide (PubChem CID 2392249) has the molecular formula C19H20ClN3O2S and a molecular weight of 389.91 g/mol. Its IUPAC name is N-butyl-N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-butyl-N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2392249 |
| Molecular Formula | C19H20ClN3O2S |
| Molecular Weight | 389.91 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-butyl-N-(3-chloroquinoxalin-2-yl)-4-methylbenzenesulfonamide |
| SMILES | CCCCN(c1nc2ccccc2nc1Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20ClN3O2S/c1-3-4-13-23(26(24,25)15-11-9-14(2)10-12-15)19-18(20)21-16-7-5-6-8-17(16)22-19/h5-12H,3-4,13H2,1-2H3 |
| InChIKey | FCSYXBYCCWBYSU-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.91 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |