C52H53BrN4O4S2 — CID 101493991
N-[6-[6-[8-[3-bromopropyl-(4-methylphenyl)sulfonylamino]phenanthridin-6-yl]hexyl]phenanthridin-8-yl]-4-methyl-N-propylbenzenesulfonamide (PubChem CID 101493991) has the molecular formula C52H53BrN4O4S2 and a molecular weight of 942.06 g/mol. Its IUPAC name is N-[6-[6-[8-[3-bromopropyl-(4-methylphenyl)sulfonylamino]phenanthridin-6-yl]hexyl]phenanthridin-8-yl]-4-methyl-N-propylbenzenesulfonamide.
| Compound Name | N-[6-[6-[8-[3-bromopropyl-(4-methylphenyl)sulfonylamino]phenanthridin-6-yl]hexyl]phenanthridin-8-yl]-4-methyl-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 101493991 |
| Molecular Formula | C52H53BrN4O4S2 |
| Molecular Weight | 942.06 g/mol |
| Exact Mass | 940.27 |
| IUPAC Name | N-[6-[6-[8-[3-bromopropyl-(4-methylphenyl)sulfonylamino]phenanthridin-6-yl]hexyl]phenanthridin-8-yl]-4-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN(c1ccc2c(c1)c(CCCCCCc1nc3ccccc3c3ccc(N(CCCBr)S(=O)(=O)c4ccc(C)cc4)cc13)nc1ccccc12)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C52H53BrN4O4S2/c1-4-33-56(62(58,59)41-26-20-37(2)21-27-41)39-24-30-43-45-14-9-11-18-49(45)54-51(47(43)35-39)16-7-5-6-8-17-52-48-36-40(25-31-44(48)46-15-10-12-19-50(46)55-52)57(34-13-32-53)63(60,61)42-28-22-38(3)23-29-42/h9-12,14-15,18-31,35-36H,4-8,13,16-17,32-34H2,1-3H3 |
| InChIKey | DEPMSCHEIZNGKJ-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 942.06 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|