C21H19BrCl2N2O4S — CID 142635736
methyl 4-[3-bromopropyl-(4-methylphenyl)sulfonylamino]-5,7-dichloroquinoline-2-carboxylate (PubChem CID 142635736) has the molecular formula C21H19BrCl2N2O4S and a molecular weight of 546.27 g/mol. Its IUPAC name is methyl 4-[3-bromopropyl-(4-methylphenyl)sulfonylamino]-5,7-dichloroquinoline-2-carboxylate.
| Compound Name | methyl 4-[3-bromopropyl-(4-methylphenyl)sulfonylamino]-5,7-dichloroquinoline-2-carboxylate |
|---|---|
| PubChem CID | 142635736 |
| Molecular Formula | C21H19BrCl2N2O4S |
| Molecular Weight | 546.27 g/mol |
| Exact Mass | 543.96 |
| IUPAC Name | methyl 4-[3-bromopropyl-(4-methylphenyl)sulfonylamino]-5,7-dichloroquinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(N(CCCBr)S(=O)(=O)c2ccc(C)cc2)c2c(Cl)cc(Cl)cc2n1 |
| InChI | InChI=1S/C21H19BrCl2N2O4S/c1-13-4-6-15(7-5-13)31(28,29)26(9-3-8-22)19-12-18(21(27)30-2)25-17-11-14(23)10-16(24)20(17)19/h4-7,10-12H,3,8-9H2,1-2H3 |
| InChIKey | KYYGWBYUWPVPGS-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.27 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|