C24H23ClN2O6S — CID 21372677
methyl 2-chloro-5-[[2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate (PubChem CID 21372677) has the molecular formula C24H23ClN2O6S and a molecular weight of 502.98 g/mol. Its IUPAC name is methyl 2-chloro-5-[[2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate.
| Compound Name | methyl 2-chloro-5-[[2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 21372677 |
| Molecular Formula | C24H23ClN2O6S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | methyl 2-chloro-5-[[2-(4-methoxy-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cc(NC(=O)CN(c2ccc(OC)cc2)S(=O)(=O)c2ccc(C)cc2)ccc1Cl |
| InChI | InChI=1S/C24H23ClN2O6S/c1-16-4-11-20(12-5-16)34(30,31)27(18-7-9-19(32-2)10-8-18)15-23(28)26-17-6-13-22(25)21(14-17)24(29)33-3/h4-14H,15H2,1-3H3,(H,26,28) |
| InChIKey | SBVYSOVFSBDOJO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |