C35H40Br2N2O4S2 — CID 13498446
N-(4-bromobutyl)-N-[4-[[4-[4-bromobutyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 13498446) has the molecular formula C35H40Br2N2O4S2 and a molecular weight of 776.66 g/mol. Its IUPAC name is N-(4-bromobutyl)-N-[4-[[4-[4-bromobutyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-(4-bromobutyl)-N-[4-[[4-[4-bromobutyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 13498446 |
| Molecular Formula | C35H40Br2N2O4S2 |
| Molecular Weight | 776.66 g/mol |
| Exact Mass | 774.08 |
| IUPAC Name | N-(4-bromobutyl)-N-[4-[[4-[4-bromobutyl-(4-methylphenyl)sulfonylamino]phenyl]methyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCCBr)c2ccc(Cc3ccc(N(CCCCBr)S(=O)(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H40Br2N2O4S2/c1-28-7-19-34(20-8-28)44(40,41)38(25-5-3-23-36)32-15-11-30(12-16-32)27-31-13-17-33(18-14-31)39(26-6-4-24-37)45(42,43)35-21-9-29(2)10-22-35/h7-22H,3-6,23-27H2,1-2H3 |
| InChIKey | SNGPSZPLOAVKTI-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.66 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|