C25H23N5O2S2 — CID 40852303
(2S)-2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-thiophen-2-ylsulfonylacetonitrile (PubChem CID 40852303) has the molecular formula C25H23N5O2S2 and a molecular weight of 489.63 g/mol. Its IUPAC name is (2S)-2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-thiophen-2-ylsulfonylacetonitrile.
| Compound Name | (2S)-2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-thiophen-2-ylsulfonylacetonitrile |
|---|---|
| PubChem CID | 40852303 |
| Molecular Formula | C25H23N5O2S2 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | (2S)-2-[3-(4-benzylpiperazin-1-yl)quinoxalin-2-yl]-2-thiophen-2-ylsulfonylacetonitrile |
| SMILES | N#C[C@H](c1nc2ccccc2nc1N1CCN(Cc2ccccc2)CC1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H23N5O2S2/c26-17-22(34(31,32)23-11-6-16-33-23)24-25(28-21-10-5-4-9-20(21)27-24)30-14-12-29(13-15-30)18-19-7-2-1-3-8-19/h1-11,16,22H,12-15,18H2/t22-/m1/s1 |
| InChIKey | GZJVDUJQNYFZGG-JOCHJYFZSA-N |
| XLogP | 4.05 |
| TPSA | 90.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |